C18H27NO4 — CID 902127
1-[(2S,3S)-2-(3,3-diethoxypropyl)-3-(hydroxymethyl)-2,3-dihydroindol-1-yl]ethanone (PubChem CID 902127) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-[(2S,3S)-2-(3,3-diethoxypropyl)-3-(hydroxymethyl)-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[(2S,3S)-2-(3,3-diethoxypropyl)-3-(hydroxymethyl)-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 902127 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 1-[(2S,3S)-2-(3,3-diethoxypropyl)-3-(hydroxymethyl)-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CCOC(CC[C@H]1[C@@H](CO)c2ccccc2N1C(C)=O)OCC |
| InChI | InChI=1S/C18H27NO4/c1-4-22-18(23-5-2)11-10-17-15(12-20)14-8-6-7-9-16(14)19(17)13(3)21/h6-9,15,17-18,20H,4-5,10-12H2,1-3H3/t15-,17-/m0/s1 |
| InChIKey | KCJQXHNSGBDBRB-RDJZCZTQSA-N |
| XLogP | 2.68 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|