C22H26N2O6 — CID 90213209
5-nitro-2-[(3-octoxybenzoyl)amino]benzoic acid (PubChem CID 90213209) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 5-nitro-2-[(3-octoxybenzoyl)amino]benzoic acid.
| Compound Name | 5-nitro-2-[(3-octoxybenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 90213209 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 5-nitro-2-[(3-octoxybenzoyl)amino]benzoic acid |
| SMILES | CCCCCCCCOc1cccc(C(=O)Nc2ccc([N+](=O)[O-])cc2C(=O)O)c1 |
| InChI | InChI=1S/C22H26N2O6/c1-2-3-4-5-6-7-13-30-18-10-8-9-16(14-18)21(25)23-20-12-11-17(24(28)29)15-19(20)22(26)27/h8-12,14-15H,2-7,13H2,1H3,(H,23,25)(H,26,27) |
| InChIKey | FSXBEEUDIJCDQI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|