C21H21N5O7S — CID 90213336
(2S)-2-[[7-(3,4-dimethoxyphenyl)pyrido[3,4-b]pyrazin-5-yl]oxymethyl]-N-(oxomethylidene)morpholine-4-sulfonamide (PubChem CID 90213336) has the molecular formula C21H21N5O7S and a molecular weight of 487.49 g/mol. Its IUPAC name is (2S)-2-[[7-(3,4-dimethoxyphenyl)pyrido[3,4-b]pyrazin-5-yl]oxymethyl]-N-(oxomethylidene)morpholine-4-sulfonamide.
| Compound Name | (2S)-2-[[7-(3,4-dimethoxyphenyl)pyrido[3,4-b]pyrazin-5-yl]oxymethyl]-N-(oxomethylidene)morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 90213336 |
| Molecular Formula | C21H21N5O7S |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | (2S)-2-[[7-(3,4-dimethoxyphenyl)pyrido[3,4-b]pyrazin-5-yl]oxymethyl]-N-(oxomethylidene)morpholine-4-sulfonamide |
| SMILES | COc1ccc(-c2cc3nccnc3c(OC[C@@H]3CN(S(=O)(=O)N=C=O)CCO3)n2)cc1OC |
| InChI | InChI=1S/C21H21N5O7S/c1-30-18-4-3-14(9-19(18)31-2)16-10-17-20(23-6-5-22-17)21(25-16)33-12-15-11-26(7-8-32-15)34(28,29)24-13-27/h3-6,9-10,15H,7-8,11-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | YGHYSIHDNAGMSN-HNNXBMFYSA-N |
| XLogP | 1.37 |
| TPSA | 142.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|