About 2-[butyl(ethyl)amino]-4-[4-(hydroxymethyl)-2,6-dimethylphenyl]-1,3-thiazole-5-carbaldehyde
2-[butyl(ethyl)amino]-4-[4-(hydroxymethyl)-2,6-dimethylphenyl]-1,3-thiazole-5-carbaldehyde (PubChem CID 90213651) has the molecular formula C19H26N2O2S
and a molecular weight of 346.50 g/mol. Its IUPAC name is 2-[butyl(ethyl)amino]-4-[4-(hydroxymethyl)-2,6-dimethylphenyl]-1,3-thiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-[butyl(ethyl)amino]-4-[4-(hydroxymethyl)-2,6-dimethylphenyl]-1,3-thiazole-5-carbaldehyde |
| PubChem CID | 90213651 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-[butyl(ethyl)amino]-4-[4-(hydroxymethyl)-2,6-dimethylphenyl]-1,3-thiazole-5-carbaldehyde |
| SMILES | CCCCN(CC)c1nc(-c2c(C)cc(CO)cc2C)c(C=O)s1 |
| InChI | InChI=1S/C19H26N2O2S/c1-5-7-8-21(6-2)19-20-18(16(12-23)24-19)17-13(3)9-15(11-22)10-14(17)4/h9-10,12,22H,5-8,11H2,1-4H3 |
| InChIKey | HZCAMPBPQRSXGF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[butyl(ethyl)amino]-4-[4-(hydroxymethyl)-2,6-dimethylphenyl]-1,3-thiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[butyl(ethyl)amino]-4-[4-(hydroxymethyl)-2,6-dimethylphenyl]-1,3-thiazole-5-carbaldehyde?
The IUPAC name of 2-[butyl(ethyl)amino]-4-[4-(hydroxymethyl)-2,6-dimethylphenyl]-1,3-thiazole-5-carbaldehyde (CID 90213651) is 2-[butyl(ethyl)amino]-4-[4-(hydroxymethyl)-2,6-dimethylphenyl]-1,3-thiazole-5-carbaldehyde.
What is the SMILES notation for 2-[butyl(ethyl)amino]-4-[4-(hydroxymethyl)-2,6-dimethylphenyl]-1,3-thiazole-5-carbaldehyde?
The canonical SMILES for 2-[butyl(ethyl)amino]-4-[4-(hydroxymethyl)-2,6-dimethylphenyl]-1,3-thiazole-5-carbaldehyde is CCCCN(CC)c1nc(-c2c(C)cc(CO)cc2C)c(C=O)s1.
What is the InChIKey of 2-[butyl(ethyl)amino]-4-[4-(hydroxymethyl)-2,6-dimethylphenyl]-1,3-thiazole-5-carbaldehyde?
The InChIKey is HZCAMPBPQRSXGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O2S/c1-5-7-8-21(6-2)19-20-18(16(12-23)24-19)17-13(3)9-15(11-22)10-14(17)4/h9-10,12,22H,5-8,11H2,1-4H3.
What are the key properties of 2-[butyl(ethyl)amino]-4-[4-(hydroxymethyl)-2,6-dimethylphenyl]-1,3-thiazole-5-carbaldehyde?
2-[butyl(ethyl)amino]-4-[4-(hydroxymethyl)-2,6-dimethylphenyl]-1,3-thiazole-5-carbaldehyde has a molecular weight of 346.50 g/mol, XLogP of 4.36, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[butyl(ethyl)amino]-4-[4-(hydroxymethyl)-2,6-dimethylphenyl]-1,3-thiazole-5-carbaldehyde is sourced from PubChem (CID 90213651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).