C43H63N5O2S — CID 90213659
(5Z)-5-[[2-[bis(2-ethylhexyl)amino]-4-(4-cyclohexyl-2,6-dimethylphenyl)-1,3-thiazol-5-yl]methylidene]-1-(dimethylamino)-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 90213659) has the molecular formula C43H63N5O2S and a molecular weight of 714.08 g/mol. Its IUPAC name is (5Z)-5-[[2-[bis(2-ethylhexyl)amino]-4-(4-cyclohexyl-2,6-dimethylphenyl)-1,3-thiazol-5-yl]methylidene]-1-(dimethylamino)-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5Z)-5-[[2-[bis(2-ethylhexyl)amino]-4-(4-cyclohexyl-2,6-dimethylphenyl)-1,3-thiazol-5-yl]methylidene]-1-(dimethylamino)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 90213659 |
| Molecular Formula | C43H63N5O2S |
| Molecular Weight | 714.08 g/mol |
| Exact Mass | 713.47 |
| IUPAC Name | (5Z)-5-[[2-[bis(2-ethylhexyl)amino]-4-(4-cyclohexyl-2,6-dimethylphenyl)-1,3-thiazol-5-yl]methylidene]-1-(dimethylamino)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1nc(-c2c(C)cc(C3CCCCC3)cc2C)c(/C=C2\C(=O)N(N(C)C)C(=O)C(C#N)=C2C)s1 |
| InChI | InChI=1S/C43H63N5O2S/c1-10-14-19-32(12-3)27-47(28-33(13-4)20-15-11-2)43-45-40(39-29(5)23-35(24-30(39)6)34-21-17-16-18-22-34)38(51-43)25-36-31(7)37(26-44)42(50)48(41(36)49)46(8)9/h23-25,32-34H,10-22,27-28H2,1-9H3/b36-25- |
| InChIKey | YNQAOOKNTAJFIP-LAKKEJQSSA-N |
| XLogP | 10.78 |
| TPSA | 80.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.08 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|