About 1-[5-(aminomethyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-1'-yl]ethanone
1-[5-(aminomethyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-1'-yl]ethanone (PubChem CID 90213719) has the molecular formula C15H20N2OS
and a molecular weight of 276.41 g/mol. Its IUPAC name is 1-[5-(aminomethyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-1'-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-(aminomethyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-1'-yl]ethanone |
| PubChem CID | 90213719 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1-[5-(aminomethyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-1'-yl]ethanone |
| SMILES | CC(=O)N1CCC2(CC1)CSc1ccc(CN)cc12 |
| InChI | InChI=1S/C15H20N2OS/c1-11(18)17-6-4-15(5-7-17)10-19-14-3-2-12(9-16)8-13(14)15/h2-3,8H,4-7,9-10,16H2,1H3 |
| InChIKey | YTCVAMKTEVVDCW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-(aminomethyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-1'-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(aminomethyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-1'-yl]ethanone?
The IUPAC name of 1-[5-(aminomethyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-1'-yl]ethanone (CID 90213719) is 1-[5-(aminomethyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-1'-yl]ethanone.
What is the SMILES notation for 1-[5-(aminomethyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-1'-yl]ethanone?
The canonical SMILES for 1-[5-(aminomethyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-1'-yl]ethanone is CC(=O)N1CCC2(CC1)CSc1ccc(CN)cc12.
What is the InChIKey of 1-[5-(aminomethyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-1'-yl]ethanone?
The InChIKey is YTCVAMKTEVVDCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2OS/c1-11(18)17-6-4-15(5-7-17)10-19-14-3-2-12(9-16)8-13(14)15/h2-3,8H,4-7,9-10,16H2,1H3.
What are the key properties of 1-[5-(aminomethyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-1'-yl]ethanone?
1-[5-(aminomethyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-1'-yl]ethanone has a molecular weight of 276.41 g/mol, XLogP of 2.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(aminomethyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-1'-yl]ethanone is sourced from PubChem (CID 90213719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).