About 3-butyl-7,8-dimethyl-1H-3-benzazepin-2-one
3-butyl-7,8-dimethyl-1H-3-benzazepin-2-one (PubChem CID 90213760) has the molecular formula C16H21NO
and a molecular weight of 243.35 g/mol. Its IUPAC name is 3-butyl-7,8-dimethyl-1H-3-benzazepin-2-one.
Molecular Properties
| Compound Name | 3-butyl-7,8-dimethyl-1H-3-benzazepin-2-one |
| PubChem CID | 90213760 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 3-butyl-7,8-dimethyl-1H-3-benzazepin-2-one |
| SMILES | CCCCN1C=Cc2cc(C)c(C)cc2CC1=O |
| InChI | InChI=1S/C16H21NO/c1-4-5-7-17-8-6-14-9-12(2)13(3)10-15(14)11-16(17)18/h6,8-10H,4-5,7,11H2,1-3H3 |
| InChIKey | RQOJKQULDUGUGJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-butyl-7,8-dimethyl-1H-3-benzazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-7,8-dimethyl-1H-3-benzazepin-2-one?
The IUPAC name of 3-butyl-7,8-dimethyl-1H-3-benzazepin-2-one (CID 90213760) is 3-butyl-7,8-dimethyl-1H-3-benzazepin-2-one.
What is the SMILES notation for 3-butyl-7,8-dimethyl-1H-3-benzazepin-2-one?
The canonical SMILES for 3-butyl-7,8-dimethyl-1H-3-benzazepin-2-one is CCCCN1C=Cc2cc(C)c(C)cc2CC1=O.
What is the InChIKey of 3-butyl-7,8-dimethyl-1H-3-benzazepin-2-one?
The InChIKey is RQOJKQULDUGUGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO/c1-4-5-7-17-8-6-14-9-12(2)13(3)10-15(14)11-16(17)18/h6,8-10H,4-5,7,11H2,1-3H3.
What are the key properties of 3-butyl-7,8-dimethyl-1H-3-benzazepin-2-one?
3-butyl-7,8-dimethyl-1H-3-benzazepin-2-one has a molecular weight of 243.35 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-7,8-dimethyl-1H-3-benzazepin-2-one is sourced from PubChem (CID 90213760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).