C8H8F8 — CID 90213776
(E)-1,1,1,7,7,8,8,8-octafluorooct-3-ene (PubChem CID 90213776) has the molecular formula C8H8F8 and a molecular weight of 256.14 g/mol. Its IUPAC name is (E)-1,1,1,7,7,8,8,8-octafluorooct-3-ene.
| Compound Name | (E)-1,1,1,7,7,8,8,8-octafluorooct-3-ene |
|---|---|
| PubChem CID | 90213776 |
| Molecular Formula | C8H8F8 |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | (E)-1,1,1,7,7,8,8,8-octafluorooct-3-ene |
| SMILES | FC(F)(F)C/C=C/CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8F8/c9-6(10,8(14,15)16)4-2-1-3-5-7(11,12)13/h1,3H,2,4-5H2/b3-1+ |
| InChIKey | FFDVSTXAUUGYEA-HNQUOIGGSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|