C22H38N2 — CID 90214436
1-N,4-N-dioctylcyclohexa-2,5-diene-1,4-diimine (PubChem CID 90214436) has the molecular formula C22H38N2 and a molecular weight of 330.56 g/mol. Its IUPAC name is 1-N,4-N-dioctylcyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 1-N,4-N-dioctylcyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 90214436 |
| Molecular Formula | C22H38N2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | 1-N,4-N-dioctylcyclohexa-2,5-diene-1,4-diimine |
| SMILES | CCCCCCCCN=C1C=CC(=NCCCCCCCC)C=C1 |
| InChI | InChI=1S/C22H38N2/c1-3-5-7-9-11-13-19-23-21-15-17-22(18-16-21)24-20-14-12-10-8-6-4-2/h15-18H,3-14,19-20H2,1-2H3/b23-21-,24-22+ |
| InChIKey | NPVANFJWJGJUJG-MMUCEYJRSA-N |
| XLogP | 6.72 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|