C21H31BN2O4 — CID 90214888
N-[4-[2-[[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]amino]-2-oxoethyl]cyclohexyl]butanamide (PubChem CID 90214888) has the molecular formula C21H31BN2O4 and a molecular weight of 386.30 g/mol. Its IUPAC name is N-[4-[2-[[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]amino]-2-oxoethyl]cyclohexyl]butanamide.
| Compound Name | N-[4-[2-[[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]amino]-2-oxoethyl]cyclohexyl]butanamide |
|---|---|
| PubChem CID | 90214888 |
| Molecular Formula | C21H31BN2O4 |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | N-[4-[2-[[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]amino]-2-oxoethyl]cyclohexyl]butanamide |
| SMILES | CCCC(=O)NC1CCC(CC(=O)N[C@H]2Cc3cccc(C)c3OB2O)CC1 |
| InChI | InChI=1S/C21H31BN2O4/c1-3-5-19(25)23-17-10-8-15(9-11-17)12-20(26)24-18-13-16-7-4-6-14(2)21(16)28-22(18)27/h4,6-7,15,17-18,27H,3,5,8-13H2,1-2H3,(H,23,25)(H,24,26)/t15?,17?,18-/m0/s1 |
| InChIKey | ZDNIIDIIOBGDEJ-VJFUWPCTSA-N |
| XLogP | 2.30 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|