C20H32BN3O3 — CID 90214889
2-[4-[(2-aminoethylamino)methyl]cyclohexyl]-N-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide (PubChem CID 90214889) has the molecular formula C20H32BN3O3 and a molecular weight of 373.31 g/mol. Its IUPAC name is 2-[4-[(2-aminoethylamino)methyl]cyclohexyl]-N-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide.
| Compound Name | 2-[4-[(2-aminoethylamino)methyl]cyclohexyl]-N-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide |
|---|---|
| PubChem CID | 90214889 |
| Molecular Formula | C20H32BN3O3 |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 2-[4-[(2-aminoethylamino)methyl]cyclohexyl]-N-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide |
| SMILES | Cc1cccc2c1OB(O)[C@@H](NC(=O)CC1CCC(CNCCN)CC1)C2 |
| InChI | InChI=1S/C20H32BN3O3/c1-14-3-2-4-17-12-18(21(26)27-20(14)17)24-19(25)11-15-5-7-16(8-6-15)13-23-10-9-22/h2-4,15-16,18,23,26H,5-13,22H2,1H3,(H,24,25)/t15?,16?,18-/m0/s1 |
| InChIKey | AHYSUNRETJOXFQ-HTWSVDAQSA-N |
| XLogP | 1.18 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|