C23H35BN4O4 — CID 90214893
2-[4-[2-[(2-amino-2-oxoethyl)amino]ethylamino]cyclohexyl]-N-[(3R)-2-hydroxy-8-prop-1-en-2-yl-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide (PubChem CID 90214893) has the molecular formula C23H35BN4O4 and a molecular weight of 442.37 g/mol. Its IUPAC name is 2-[4-[2-[(2-amino-2-oxoethyl)amino]ethylamino]cyclohexyl]-N-[(3R)-2-hydroxy-8-prop-1-en-2-yl-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide.
| Compound Name | 2-[4-[2-[(2-amino-2-oxoethyl)amino]ethylamino]cyclohexyl]-N-[(3R)-2-hydroxy-8-prop-1-en-2-yl-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide |
|---|---|
| PubChem CID | 90214893 |
| Molecular Formula | C23H35BN4O4 |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 2-[4-[2-[(2-amino-2-oxoethyl)amino]ethylamino]cyclohexyl]-N-[(3R)-2-hydroxy-8-prop-1-en-2-yl-3,4-dihydro-1,2-benzoxaborinin-3-yl]acetamide |
| SMILES | C=C(C)c1cccc2c1OB(O)[C@@H](NC(=O)CC1CCC(NCCNCC(N)=O)CC1)C2 |
| InChI | InChI=1S/C23H35BN4O4/c1-15(2)19-5-3-4-17-13-20(24(31)32-23(17)19)28-22(30)12-16-6-8-18(9-7-16)27-11-10-26-14-21(25)29/h3-5,16,18,20,26-27,31H,1,6-14H2,2H3,(H2,25,29)(H,28,30)/t16?,18?,20-/m0/s1 |
| InChIKey | OTZPUZCZASVPOJ-NLPFYKDJSA-N |
| XLogP | 0.77 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|