C21H32BN3O4 — CID 90214906
N-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-[4-(propylcarbamoylamino)cyclohexyl]acetamide (PubChem CID 90214906) has the molecular formula C21H32BN3O4 and a molecular weight of 401.32 g/mol. Its IUPAC name is N-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-[4-(propylcarbamoylamino)cyclohexyl]acetamide.
| Compound Name | N-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-[4-(propylcarbamoylamino)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 90214906 |
| Molecular Formula | C21H32BN3O4 |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | N-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-[4-(propylcarbamoylamino)cyclohexyl]acetamide |
| SMILES | CCCNC(=O)NC1CCC(CC(=O)N[C@H]2Cc3cccc(C)c3OB2O)CC1 |
| InChI | InChI=1S/C21H32BN3O4/c1-3-11-23-21(27)24-17-9-7-15(8-10-17)12-19(26)25-18-13-16-6-4-5-14(2)20(16)29-22(18)28/h4-6,15,17-18,28H,3,7-13H2,1-2H3,(H,25,26)(H2,23,24,27)/t15?,17?,18-/m0/s1 |
| InChIKey | KISOOOUGEMNOOI-VJFUWPCTSA-N |
| XLogP | 2.09 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|