C52H100O7Si4 — CID 90215226
[(2R,3R,4R,5R)-2,3,4,5-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxyhexyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 90215226) has the molecular formula C52H100O7Si4 and a molecular weight of 949.71 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2,3,4,5-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxyhexyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [(2R,3R,4R,5R)-2,3,4,5-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxyhexyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 90215226 |
| Molecular Formula | C52H100O7Si4 |
| Molecular Weight | 949.71 g/mol |
| Exact Mass | 948.65 |
| IUPAC Name | [(2R,3R,4R,5R)-2,3,4,5-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxyhexyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C52H100O7Si4/c1-22-23-24-25-26-27-28-29-30-31-32-33-34-35-36-37-38-39-40-41-46(54)55-43-45(57-61(16,17)50(5,6)7)48(59-63(20,21)52(11,12)13)47(58-62(18,19)51(8,9)10)44(42-53)56-60(14,15)49(2,3)4/h23-24,26-27,29-30,32-33,35-36,38-39,44-45,47-48,53H,22,25,28,31,34,37,40-43H2,1-21H3/b24-23-,27-26-,30-29-,33-32-,36-35-,39-38-/t44-,45-,47-,48-/m1/s1 |
| InChIKey | STZZMKVMOLSELI-GRGNFPHXSA-N |
| XLogP | 15.56 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.71 |
| LogP ≤ 5 | 15.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|