C34H50O9 — CID 90215256
4-O-[(2R,3S,4R,5R)-6-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-2,3,4-trihydroxy-5-methylhexyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 90215256) has the molecular formula C34H50O9 and a molecular weight of 602.77 g/mol. Its IUPAC name is 4-O-[(2R,3S,4R,5R)-6-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-2,3,4-trihydroxy-5-methylhexyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(2R,3S,4R,5R)-6-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-2,3,4-trihydroxy-5-methylhexyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 90215256 |
| Molecular Formula | C34H50O9 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.35 |
| IUPAC Name | 4-O-[(2R,3S,4R,5R)-6-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-2,3,4-trihydroxy-5-methylhexyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC[C@@H](C)[C@@H](O)[C@H](O)[C@H](O)COC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C34H50O9/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-31(37)42-26-28(2)33(39)34(40)29(35)27-43-32(38)25-24-30(36)41-3/h5-6,8-9,11-12,14-15,17-18,20-21,24-25,28-29,33-35,39-40H,4,7,10,13,16,19,22-23,26-27H2,1-3H3/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20-,25-24+/t28-,29-,33-,34-/m1/s1 |
| InChIKey | TXWWJZIIBHQPKN-ZWDCMPQNSA-N |
| XLogP | 5.00 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|