C27H60O6Si3 — CID 90215261
[(2R,3R,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxy-2-methylhexyl] acetate (PubChem CID 90215261) has the molecular formula C27H60O6Si3 and a molecular weight of 565.03 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxy-2-methylhexyl] acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxy-2-methylhexyl] acetate |
|---|---|
| PubChem CID | 90215261 |
| Molecular Formula | C27H60O6Si3 |
| Molecular Weight | 565.03 g/mol |
| Exact Mass | 564.37 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxy-2-methylhexyl] acetate |
| SMILES | CC(=O)OC[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H60O6Si3/c1-20(19-30-21(2)29)23(32-35(14,15)26(6,7)8)24(33-36(16,17)27(9,10)11)22(18-28)31-34(12,13)25(3,4)5/h20,22-24,28H,18-19H2,1-17H3/t20-,22-,23-,24-/m1/s1 |
| InChIKey | PGNXSSUWXNCSSV-MSNJVRRCSA-N |
| XLogP | 7.35 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.03 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|