C34H56IN3O5S2 — CID 90215407
[(2R)-1-[[3-[2-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyldisulfanyl]ethylamino]-3-oxopropyl]amino]-4-methoxy-3,3-dimethyl-1-oxobutan-2-yl] hypoiodite (PubChem CID 90215407) has the molecular formula C34H56IN3O5S2 and a molecular weight of 777.88 g/mol. Its IUPAC name is [(2R)-1-[[3-[2-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyldisulfanyl]ethylamino]-3-oxopropyl]amino]-4-methoxy-3,3-dimethyl-1-oxobutan-2-yl] hypoiodite.
| Compound Name | [(2R)-1-[[3-[2-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyldisulfanyl]ethylamino]-3-oxopropyl]amino]-4-methoxy-3,3-dimethyl-1-oxobutan-2-yl] hypoiodite |
|---|---|
| PubChem CID | 90215407 |
| Molecular Formula | C34H56IN3O5S2 |
| Molecular Weight | 777.88 g/mol |
| Exact Mass | 777.27 |
| IUPAC Name | [(2R)-1-[[3-[2-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyldisulfanyl]ethylamino]-3-oxopropyl]amino]-4-methoxy-3,3-dimethyl-1-oxobutan-2-yl] hypoiodite |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCSSCCNC(=O)CCNC(=O)[C@H](OI)C(C)(C)COC |
| InChI | InChI=1S/C34H56IN3O5S2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-30(39)36-25-27-44-45-28-26-37-31(40)23-24-38-33(41)32(43-35)34(2,3)29-42-4/h6-7,9-10,12-13,15-16,18-19,32H,5,8,11,14,17,20-29H2,1-4H3,(H,36,39)(H,37,40)(H,38,41)/b7-6-,10-9-,13-12-,16-15-,19-18-/t32-/m0/s1 |
| InChIKey | SNXMYGWHOXEATA-KZJSIZHPSA-N |
| XLogP | 7.44 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.88 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|