C35H57N3O5S2 — CID 90215424
(3Z,6Z,9Z,12Z,15Z,18Z)-N-[2-[2-[3-[[(2R)-2-hydroxy-4-methoxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyldisulfanyl]ethyl]henicosa-3,6,9,12,15,18-hexaenamide (PubChem CID 90215424) has the molecular formula C35H57N3O5S2 and a molecular weight of 663.99 g/mol. Its IUPAC name is (3Z,6Z,9Z,12Z,15Z,18Z)-N-[2-[2-[3-[[(2R)-2-hydroxy-4-methoxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyldisulfanyl]ethyl]henicosa-3,6,9,12,15,18-hexaenamide.
| Compound Name | (3Z,6Z,9Z,12Z,15Z,18Z)-N-[2-[2-[3-[[(2R)-2-hydroxy-4-methoxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyldisulfanyl]ethyl]henicosa-3,6,9,12,15,18-hexaenamide |
|---|---|
| PubChem CID | 90215424 |
| Molecular Formula | C35H57N3O5S2 |
| Molecular Weight | 663.99 g/mol |
| Exact Mass | 663.37 |
| IUPAC Name | (3Z,6Z,9Z,12Z,15Z,18Z)-N-[2-[2-[3-[[(2R)-2-hydroxy-4-methoxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyldisulfanyl]ethyl]henicosa-3,6,9,12,15,18-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(=O)NCCSSCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COC |
| InChI | InChI=1S/C35H57N3O5S2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-31(39)36-26-28-44-45-29-27-37-32(40)24-25-38-34(42)33(41)35(2,3)30-43-4/h6-7,9-10,12-13,15-16,18-19,21-22,33,41H,5,8,11,14,17,20,23-30H2,1-4H3,(H,36,39)(H,37,40)(H,38,42)/b7-6-,10-9-,13-12-,16-15-,19-18-,22-21-/t33-/m0/s1 |
| InChIKey | VYYGEYLZQLDAOO-STVKZLKSSA-N |
| XLogP | 6.23 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.99 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|