C19H31IO — CID 90215616
(6S)-6-[(1E,3E)-5-(4-iodocyclohexyl)-3-methylpenta-1,3-dienyl]-2,2-dimethyloxane (PubChem CID 90215616) has the molecular formula C19H31IO and a molecular weight of 402.36 g/mol. Its IUPAC name is (6S)-6-[(1E,3E)-5-(4-iodocyclohexyl)-3-methylpenta-1,3-dienyl]-2,2-dimethyloxane.
| Compound Name | (6S)-6-[(1E,3E)-5-(4-iodocyclohexyl)-3-methylpenta-1,3-dienyl]-2,2-dimethyloxane |
|---|---|
| PubChem CID | 90215616 |
| Molecular Formula | C19H31IO |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | (6S)-6-[(1E,3E)-5-(4-iodocyclohexyl)-3-methylpenta-1,3-dienyl]-2,2-dimethyloxane |
| SMILES | CC(/C=C/[C@@H]1CCCC(C)(C)O1)=C\CC1CCC(I)CC1 |
| InChI | InChI=1S/C19H31IO/c1-15(6-8-16-9-11-17(20)12-10-16)7-13-18-5-4-14-19(2,3)21-18/h6-7,13,16-18H,4-5,8-12,14H2,1-3H3/b13-7+,15-6+/t16?,17?,18-/m0/s1 |
| InChIKey | FJTHYTCZGCPQGL-FBJVOEMASA-N |
| XLogP | 6.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|