C30H46O5Si2 — CID 90215685
4-[(1R,3aS,8bS)-1-[(E,3S)-4-methyl-3-trimethylsilyloxyoct-1-en-6-ynyl]-2-trimethylsilyloxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoic acid (PubChem CID 90215685) has the molecular formula C30H46O5Si2 and a molecular weight of 542.87 g/mol. Its IUPAC name is 4-[(1R,3aS,8bS)-1-[(E,3S)-4-methyl-3-trimethylsilyloxyoct-1-en-6-ynyl]-2-trimethylsilyloxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoic acid.
| Compound Name | 4-[(1R,3aS,8bS)-1-[(E,3S)-4-methyl-3-trimethylsilyloxyoct-1-en-6-ynyl]-2-trimethylsilyloxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoic acid |
|---|---|
| PubChem CID | 90215685 |
| Molecular Formula | C30H46O5Si2 |
| Molecular Weight | 542.87 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | 4-[(1R,3aS,8bS)-1-[(E,3S)-4-methyl-3-trimethylsilyloxyoct-1-en-6-ynyl]-2-trimethylsilyloxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]butanoic acid |
| SMILES | CC#CCC(C)[C@@H](/C=C/[C@H]1C(O[Si](C)(C)C)C[C@@H]2Oc3c(CCCC(=O)O)cccc3[C@@H]21)O[Si](C)(C)C |
| InChI | InChI=1S/C30H46O5Si2/c1-9-10-13-21(2)25(34-36(3,4)5)19-18-23-26(35-37(6,7)8)20-27-29(23)24-16-11-14-22(30(24)33-27)15-12-17-28(31)32/h11,14,16,18-19,21,23,25-27,29H,12-13,15,17,20H2,1-8H3,(H,31,32)/b19-18+/t21?,23-,25+,26?,27-,29-/m0/s1 |
| InChIKey | FYMLMXKOBPNUQG-NJTLEZRUSA-N |
| XLogP | 7.00 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.87 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|