C17H26N2O4 — CID 90216616
[6-[carboxy(prop-2-ynyl)amino]-2,2,4-trimethylhexyl]-prop-2-ynylcarbamic acid (PubChem CID 90216616) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is [6-[carboxy(prop-2-ynyl)amino]-2,2,4-trimethylhexyl]-prop-2-ynylcarbamic acid.
| Compound Name | [6-[carboxy(prop-2-ynyl)amino]-2,2,4-trimethylhexyl]-prop-2-ynylcarbamic acid |
|---|---|
| PubChem CID | 90216616 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | [6-[carboxy(prop-2-ynyl)amino]-2,2,4-trimethylhexyl]-prop-2-ynylcarbamic acid |
| SMILES | C#CCN(CCC(C)CC(C)(C)CN(CC#C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H26N2O4/c1-6-9-18(15(20)21)11-8-14(3)12-17(4,5)13-19(10-7-2)16(22)23/h1-2,14H,8-13H2,3-5H3,(H,20,21)(H,22,23) |
| InChIKey | CIMRFFNYCQGJPL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|