C35H40N4O6S — CID 90217115
[2-[[4-[(2-ethoxyquinolin-6-yl)sulfonylamino]cyclohexanecarbonyl]amino]-2-phenylethyl] 2-amino-3-phenylpropanoate (PubChem CID 90217115) has the molecular formula C35H40N4O6S and a molecular weight of 644.79 g/mol. Its IUPAC name is [2-[[4-[(2-ethoxyquinolin-6-yl)sulfonylamino]cyclohexanecarbonyl]amino]-2-phenylethyl] 2-amino-3-phenylpropanoate.
| Compound Name | [2-[[4-[(2-ethoxyquinolin-6-yl)sulfonylamino]cyclohexanecarbonyl]amino]-2-phenylethyl] 2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 90217115 |
| Molecular Formula | C35H40N4O6S |
| Molecular Weight | 644.79 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | [2-[[4-[(2-ethoxyquinolin-6-yl)sulfonylamino]cyclohexanecarbonyl]amino]-2-phenylethyl] 2-amino-3-phenylpropanoate |
| SMILES | CCOc1ccc2cc(S(=O)(=O)NC3CCC(C(=O)NC(COC(=O)C(N)Cc4ccccc4)c4ccccc4)CC3)ccc2n1 |
| InChI | InChI=1S/C35H40N4O6S/c1-2-44-33-20-15-27-22-29(18-19-31(27)37-33)46(42,43)39-28-16-13-26(14-17-28)34(40)38-32(25-11-7-4-8-12-25)23-45-35(41)30(36)21-24-9-5-3-6-10-24/h3-12,15,18-20,22,26,28,30,32,39H,2,13-14,16-17,21,23,36H2,1H3,(H,38,40) |
| InChIKey | KFQSZIPTJKMBGD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 149.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.79 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |