C32H29F3N6O6 — CID 90217360
methyl 5-[4-cyano-2-[3-[3-(hydroxymethyl)pyridin-1-ium-1-yl]propyl]phenyl]-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carboxylate formate (PubChem CID 90217360) has the molecular formula C32H29F3N6O6 and a molecular weight of 650.61 g/mol. Its IUPAC name is methyl 5-[4-cyano-2-[3-[3-(hydroxymethyl)pyridin-1-ium-1-yl]propyl]phenyl]-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carboxylate formate.
| Compound Name | methyl 5-[4-cyano-2-[3-[3-(hydroxymethyl)pyridin-1-ium-1-yl]propyl]phenyl]-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carboxylate formate |
|---|---|
| PubChem CID | 90217360 |
| Molecular Formula | C32H29F3N6O6 |
| Molecular Weight | 650.61 g/mol |
| Exact Mass | 650.21 |
| IUPAC Name | methyl 5-[4-cyano-2-[3-[3-(hydroxymethyl)pyridin-1-ium-1-yl]propyl]phenyl]-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carboxylate formate |
| SMILES | COC(=O)C1=C(C)N(c2cccc(C(F)(F)F)c2)c2n[nH]c(=O)n2C1c1ccc(C#N)cc1CCC[n+]1cccc(CO)c1.O=C[O-] |
| InChI | InChI=1S/C31H27F3N6O4.CH2O2/c1-19-26(28(42)44-2)27(40-29(36-37-30(40)43)39(19)24-9-3-8-23(15-24)31(32,33)34)25-11-10-20(16-35)14-22(25)7-5-13-38-12-4-6-21(17-38)18-41;2-1-3/h3-4,6,8-12,14-15,17,27,41H,5,7,13,18H2,1-2H3;1H,(H,2,3) |
| InChIKey | YNJOEYGHVFXXSN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 168.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.61 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|