C30H29F5N6O5 — CID 90217854
methyl 5-[4-cyano-2-[(4,4-difluoro-1-methylpiperidin-1-ium-1-yl)methyl]phenyl]-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carboxylate formate (PubChem CID 90217854) has the molecular formula C30H29F5N6O5 and a molecular weight of 648.59 g/mol. Its IUPAC name is methyl 5-[4-cyano-2-[(4,4-difluoro-1-methylpiperidin-1-ium-1-yl)methyl]phenyl]-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carboxylate formate.
| Compound Name | methyl 5-[4-cyano-2-[(4,4-difluoro-1-methylpiperidin-1-ium-1-yl)methyl]phenyl]-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carboxylate formate |
|---|---|
| PubChem CID | 90217854 |
| Molecular Formula | C30H29F5N6O5 |
| Molecular Weight | 648.59 g/mol |
| Exact Mass | 648.21 |
| IUPAC Name | methyl 5-[4-cyano-2-[(4,4-difluoro-1-methylpiperidin-1-ium-1-yl)methyl]phenyl]-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carboxylate formate |
| SMILES | COC(=O)C1=C(C)N(c2cccc(C(F)(F)F)c2)c2n[nH]c(=O)n2C1c1ccc(C#N)cc1C[N+]1(C)CCC(F)(F)CC1.O=C[O-] |
| InChI | InChI=1S/C29H27F5N6O3.CH2O2/c1-17-23(25(41)43-3)24(22-8-7-18(15-35)13-19(22)16-40(2)11-9-28(30,31)10-12-40)39-26(36-37-27(39)42)38(17)21-6-4-5-20(14-21)29(32,33)34;2-1-3/h4-8,13-14,24H,9-12,16H2,1-3H3;1H,(H,2,3) |
| InChIKey | ZFNQMEVOWZTVAA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|