About 7-ethyl-4-[4-fluoro-3-(2-methoxy-4-methylsulfonylphenyl)phenyl]imidazo[4,5-c]pyridazine
7-ethyl-4-[4-fluoro-3-(2-methoxy-4-methylsulfonylphenyl)phenyl]imidazo[4,5-c]pyridazine (PubChem CID 90218025) has the molecular formula C21H19FN4O3S
and a molecular weight of 426.47 g/mol. Its IUPAC name is 7-ethyl-4-[4-fluoro-3-(2-methoxy-4-methylsulfonylphenyl)phenyl]imidazo[4,5-c]pyridazine.
Molecular Properties
| Compound Name | 7-ethyl-4-[4-fluoro-3-(2-methoxy-4-methylsulfonylphenyl)phenyl]imidazo[4,5-c]pyridazine |
| PubChem CID | 90218025 |
| Molecular Formula | C21H19FN4O3S |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 7-ethyl-4-[4-fluoro-3-(2-methoxy-4-methylsulfonylphenyl)phenyl]imidazo[4,5-c]pyridazine |
| SMILES | CCn1cnc2c(-c3ccc(F)c(-c4ccc(S(C)(=O)=O)cc4OC)c3)cnnc21 |
| InChI | InChI=1S/C21H19FN4O3S/c1-4-26-12-23-20-17(11-24-25-21(20)26)13-5-8-18(22)16(9-13)15-7-6-14(30(3,27)28)10-19(15)29-2/h5-12H,4H2,1-3H3 |
| InChIKey | XMEKCOQJJFUWHE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-ethyl-4-[4-fluoro-3-(2-methoxy-4-methylsulfonylphenyl)phenyl]imidazo[4,5-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-4-[4-fluoro-3-(2-methoxy-4-methylsulfonylphenyl)phenyl]imidazo[4,5-c]pyridazine?
The IUPAC name of 7-ethyl-4-[4-fluoro-3-(2-methoxy-4-methylsulfonylphenyl)phenyl]imidazo[4,5-c]pyridazine (CID 90218025) is 7-ethyl-4-[4-fluoro-3-(2-methoxy-4-methylsulfonylphenyl)phenyl]imidazo[4,5-c]pyridazine.
What is the SMILES notation for 7-ethyl-4-[4-fluoro-3-(2-methoxy-4-methylsulfonylphenyl)phenyl]imidazo[4,5-c]pyridazine?
The canonical SMILES for 7-ethyl-4-[4-fluoro-3-(2-methoxy-4-methylsulfonylphenyl)phenyl]imidazo[4,5-c]pyridazine is CCn1cnc2c(-c3ccc(F)c(-c4ccc(S(C)(=O)=O)cc4OC)c3)cnnc21.
What is the InChIKey of 7-ethyl-4-[4-fluoro-3-(2-methoxy-4-methylsulfonylphenyl)phenyl]imidazo[4,5-c]pyridazine?
The InChIKey is XMEKCOQJJFUWHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FN4O3S/c1-4-26-12-23-20-17(11-24-25-21(20)26)13-5-8-18(22)16(9-13)15-7-6-14(30(3,27)28)10-19(15)29-2/h5-12H,4H2,1-3H3.
What are the key properties of 7-ethyl-4-[4-fluoro-3-(2-methoxy-4-methylsulfonylphenyl)phenyl]imidazo[4,5-c]pyridazine?
7-ethyl-4-[4-fluoro-3-(2-methoxy-4-methylsulfonylphenyl)phenyl]imidazo[4,5-c]pyridazine has a molecular weight of 426.47 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-4-[4-fluoro-3-(2-methoxy-4-methylsulfonylphenyl)phenyl]imidazo[4,5-c]pyridazine is sourced from PubChem (CID 90218025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).