C21H27ClF2NO3PS — CID 90218187
[3-[[3-chloro-4-(5-phenylpentylsulfanyl)phenyl]methylamino]-1,1-difluoropropyl]phosphonic acid (PubChem CID 90218187) has the molecular formula C21H27ClF2NO3PS and a molecular weight of 477.94 g/mol. Its IUPAC name is [3-[[3-chloro-4-(5-phenylpentylsulfanyl)phenyl]methylamino]-1,1-difluoropropyl]phosphonic acid.
| Compound Name | [3-[[3-chloro-4-(5-phenylpentylsulfanyl)phenyl]methylamino]-1,1-difluoropropyl]phosphonic acid |
|---|---|
| PubChem CID | 90218187 |
| Molecular Formula | C21H27ClF2NO3PS |
| Molecular Weight | 477.94 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | [3-[[3-chloro-4-(5-phenylpentylsulfanyl)phenyl]methylamino]-1,1-difluoropropyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)CCNCc1ccc(SCCCCCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C21H27ClF2NO3PS/c22-19-15-18(16-25-13-12-21(23,24)29(26,27)28)10-11-20(19)30-14-6-2-5-9-17-7-3-1-4-8-17/h1,3-4,7-8,10-11,15,25H,2,5-6,9,12-14,16H2,(H2,26,27,28) |
| InChIKey | GZEUJFSPICIMEG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.94 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|