C8H4BrCl2F3O — CID 90218259
1-(4-bromo-3,5-dichlorophenyl)-2,2,2-trifluoroethanol (PubChem CID 90218259) has the molecular formula C8H4BrCl2F3O and a molecular weight of 323.92 g/mol. Its IUPAC name is 1-(4-bromo-3,5-dichlorophenyl)-2,2,2-trifluoroethanol.
| Compound Name | 1-(4-bromo-3,5-dichlorophenyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 90218259 |
| Molecular Formula | C8H4BrCl2F3O |
| Molecular Weight | 323.92 g/mol |
| Exact Mass | 321.88 |
| IUPAC Name | 1-(4-bromo-3,5-dichlorophenyl)-2,2,2-trifluoroethanol |
| SMILES | OC(c1cc(Cl)c(Br)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C8H4BrCl2F3O/c9-6-4(10)1-3(2-5(6)11)7(15)8(12,13)14/h1-2,7,15H |
| InChIKey | RMZFMGQTNGROMG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.92 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|