About triethyl(hexyl)azanium acetate
triethyl(hexyl)azanium acetate (PubChem CID 90219032) has the molecular formula C14H31NO2
and a molecular weight of 245.41 g/mol. Its IUPAC name is triethyl(hexyl)azanium acetate.
Molecular Properties
| Compound Name | triethyl(hexyl)azanium acetate |
| PubChem CID | 90219032 |
| Molecular Formula | C14H31NO2 |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.24 |
| IUPAC Name | triethyl(hexyl)azanium acetate |
| SMILES | CC(=O)[O-].CCCCCC[N+](CC)(CC)CC |
| InChI | InChI=1S/C12H28N.C2H4O2/c1-5-9-10-11-12-13(6-2,7-3)8-4;1-2(3)4/h5-12H2,1-4H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | CEMAUGUEKDOHKW-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl(hexyl)azanium acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl(hexyl)azanium acetate?
The IUPAC name of triethyl(hexyl)azanium acetate (CID 90219032) is triethyl(hexyl)azanium acetate.
What is the SMILES notation for triethyl(hexyl)azanium acetate?
The canonical SMILES for triethyl(hexyl)azanium acetate is CC(=O)[O-].CCCCCC[N+](CC)(CC)CC.
What is the InChIKey of triethyl(hexyl)azanium acetate?
The InChIKey is CEMAUGUEKDOHKW-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H28N.C2H4O2/c1-5-9-10-11-12-13(6-2,7-3)8-4;1-2(3)4/h5-12H2,1-4H3;1H3,(H,3,4)/q+1;/p-1.
What are the key properties of triethyl(hexyl)azanium acetate?
triethyl(hexyl)azanium acetate has a molecular weight of 245.41 g/mol, XLogP of 2.20, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl(hexyl)azanium acetate is sourced from PubChem (CID 90219032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).