About 5-(3-bromo-2-nitrophenyl)-1,2-diphenylimidazole
5-(3-bromo-2-nitrophenyl)-1,2-diphenylimidazole (PubChem CID 90219443) has the molecular formula C21H14BrN3O2
and a molecular weight of 420.27 g/mol. Its IUPAC name is 5-(3-bromo-2-nitrophenyl)-1,2-diphenylimidazole.
Molecular Properties
| Compound Name | 5-(3-bromo-2-nitrophenyl)-1,2-diphenylimidazole |
| PubChem CID | 90219443 |
| Molecular Formula | C21H14BrN3O2 |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 5-(3-bromo-2-nitrophenyl)-1,2-diphenylimidazole |
| SMILES | O=[N+]([O-])c1c(Br)cccc1-c1cnc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C21H14BrN3O2/c22-18-13-7-12-17(20(18)25(26)27)19-14-23-21(15-8-3-1-4-9-15)24(19)16-10-5-2-6-11-16/h1-14H |
| InChIKey | VBFNMLPRHXVNAU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-bromo-2-nitrophenyl)-1,2-diphenylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-bromo-2-nitrophenyl)-1,2-diphenylimidazole?
The IUPAC name of 5-(3-bromo-2-nitrophenyl)-1,2-diphenylimidazole (CID 90219443) is 5-(3-bromo-2-nitrophenyl)-1,2-diphenylimidazole.
What is the SMILES notation for 5-(3-bromo-2-nitrophenyl)-1,2-diphenylimidazole?
The canonical SMILES for 5-(3-bromo-2-nitrophenyl)-1,2-diphenylimidazole is O=[N+]([O-])c1c(Br)cccc1-c1cnc(-c2ccccc2)n1-c1ccccc1.
What is the InChIKey of 5-(3-bromo-2-nitrophenyl)-1,2-diphenylimidazole?
The InChIKey is VBFNMLPRHXVNAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14BrN3O2/c22-18-13-7-12-17(20(18)25(26)27)19-14-23-21(15-8-3-1-4-9-15)24(19)16-10-5-2-6-11-16/h1-14H.
What are the key properties of 5-(3-bromo-2-nitrophenyl)-1,2-diphenylimidazole?
5-(3-bromo-2-nitrophenyl)-1,2-diphenylimidazole has a molecular weight of 420.27 g/mol, XLogP of 5.88, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-bromo-2-nitrophenyl)-1,2-diphenylimidazole is sourced from PubChem (CID 90219443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).