[9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid

C27H22BNO2 — CID 90219546

IUPAC[9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid
SMILESCC1(C)c2ccccc2-c2ccc(-n3c4ccccc4c4cc(B(O)O)ccc43)cc21
InChIInChI=1S/C27H22BNO2/c1-27(2)23-9-5-3-7-19(23)20-13-12-18(16-24(20)27)29-25-10-6-4-8-21(25)22-15-17(28(30)31)11-14-26(22)29/h3-16,30-31H,1-2H3
InChIKeyUKQWNEQRMXLJCK-UHFFFAOYSA-N
MW403.29 g/mol
LogP4.77
Rot. Bonds2

About [9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid

[9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid (PubChem CID 90219546) has the molecular formula C27H22BNO2 and a molecular weight of 403.29 g/mol. Its IUPAC name is [9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid.

Molecular Properties

Compound Name[9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid
PubChem CID90219546
Molecular FormulaC27H22BNO2
Molecular Weight403.29 g/mol
Exact Mass403.17
IUPAC Name[9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid
SMILESCC1(C)c2ccccc2-c2ccc(-n3c4ccccc4c4cc(B(O)O)ccc43)cc21
InChIInChI=1S/C27H22BNO2/c1-27(2)23-9-5-3-7-19(23)20-13-12-18(16-24(20)27)29-25-10-6-4-8-21(25)22-15-17(28(30)31)11-14-26(22)29/h3-16,30-31H,1-2H3
InChIKeyUKQWNEQRMXLJCK-UHFFFAOYSA-N
XLogP4.77
TPSA45.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms31
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500403.29
LogP ≤ 54.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid?
The IUPAC name of [9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid (CID 90219546) is [9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid.
What is the SMILES notation for [9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid?
The canonical SMILES for [9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid is CC1(C)c2ccccc2-c2ccc(-n3c4ccccc4c4cc(B(O)O)ccc43)cc21.
What is the InChIKey of [9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid?
The InChIKey is UKQWNEQRMXLJCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22BNO2/c1-27(2)23-9-5-3-7-19(23)20-13-12-18(16-24(20)27)29-25-10-6-4-8-21(25)22-15-17(28(30)31)11-14-26(22)29/h3-16,30-31H,1-2H3.
What are the key properties of [9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid?
[9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid has a molecular weight of 403.29 g/mol, XLogP of 4.77, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [9-(9,9-dimethylfluoren-2-yl)carbazol-3-yl]boronic acid is sourced from PubChem (CID 90219546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).