C20H25N5O4 — CID 90219576
1-(1,8-dimethyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)-1,7-diazaspiro[3.5]nonane-7-carboxylic acid (PubChem CID 90219576) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 1-(1,8-dimethyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)-1,7-diazaspiro[3.5]nonane-7-carboxylic acid.
| Compound Name | 1-(1,8-dimethyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)-1,7-diazaspiro[3.5]nonane-7-carboxylic acid |
|---|---|
| PubChem CID | 90219576 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-(1,8-dimethyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)-1,7-diazaspiro[3.5]nonane-7-carboxylic acid |
| SMILES | Cc1cc2c(cc1N1CCC13CCN(C(=O)O)CC3)N1C(=NNC(=O)C1C)CO2 |
| InChI | InChI=1S/C20H25N5O4/c1-12-9-16-15(25-13(2)18(26)22-21-17(25)11-29-16)10-14(12)24-8-5-20(24)3-6-23(7-4-20)19(27)28/h9-10,13H,3-8,11H2,1-2H3,(H,22,26)(H,27,28) |
| InChIKey | SUVVWNAPHDBBIJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|