C13H16O10 — CID 90219985
(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxy-4-(3,4,5-trihydroxybenzoyl)hexanal (PubChem CID 90219985) has the molecular formula C13H16O10 and a molecular weight of 332.26 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2,3,4,5,6-pentahydroxy-4-(3,4,5-trihydroxybenzoyl)hexanal.
| Compound Name | (2R,3R,4R,5R)-2,3,4,5,6-pentahydroxy-4-(3,4,5-trihydroxybenzoyl)hexanal |
|---|---|
| PubChem CID | 90219985 |
| Molecular Formula | C13H16O10 |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | (2R,3R,4R,5R)-2,3,4,5,6-pentahydroxy-4-(3,4,5-trihydroxybenzoyl)hexanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@@](O)(C(=O)c1cc(O)c(O)c(O)c1)[C@H](O)CO |
| InChI | InChI=1S/C13H16O10/c14-3-8(18)12(22)13(23,9(19)4-15)11(21)5-1-6(16)10(20)7(17)2-5/h1-3,8-9,12,15-20,22-23H,4H2/t8-,9+,12+,13-/m0/s1 |
| InChIKey | QFHNNBLCDKKBMV-ZFWZSOMGSA-N |
| XLogP | -3.01 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|