C12H21N5O7S — CID 90220030
[(2S,5R)-2-carbamoyl-7-oxo-2-(piperazin-2-ylmethoxy)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 90220030) has the molecular formula C12H21N5O7S and a molecular weight of 379.40 g/mol. Its IUPAC name is [(2S,5R)-2-carbamoyl-7-oxo-2-(piperazin-2-ylmethoxy)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-carbamoyl-7-oxo-2-(piperazin-2-ylmethoxy)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90220030 |
| Molecular Formula | C12H21N5O7S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [(2S,5R)-2-carbamoyl-7-oxo-2-(piperazin-2-ylmethoxy)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(=O)[C@@]1(OCC2CNCCN2)CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C12H21N5O7S/c13-10(18)12(23-7-8-5-14-3-4-15-8)2-1-9-6-16(12)11(19)17(9)24-25(20,21)22/h8-9,14-15H,1-7H2,(H2,13,18)(H,20,21,22)/t8?,9-,12+/m1/s1 |
| InChIKey | UWKQBCGPKNZOKI-IBMSWFNTSA-N |
| XLogP | -2.62 |
| TPSA | 163.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|