C13H23N4O7S+ — CID 90220222
[(2S,5R)-2-carbamoyl-7-oxo-1-(piperidin-3-ylmethoxy)-6-aza-1-azoniabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 90220222) has the molecular formula C13H23N4O7S+ and a molecular weight of 379.42 g/mol. Its IUPAC name is [(2S,5R)-2-carbamoyl-7-oxo-1-(piperidin-3-ylmethoxy)-6-aza-1-azoniabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-carbamoyl-7-oxo-1-(piperidin-3-ylmethoxy)-6-aza-1-azoniabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90220222 |
| Molecular Formula | C13H23N4O7S+ |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | [(2S,5R)-2-carbamoyl-7-oxo-1-(piperidin-3-ylmethoxy)-6-aza-1-azoniabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(=O)[C@@H]1CC[C@@H]2C[N+]1(OCC1CCCNC1)C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H22N4O7S/c14-12(18)11-4-3-10-7-17(11,13(19)16(10)24-25(20,21)22)23-8-9-2-1-5-15-6-9/h9-11,15H,1-8H2,(H2-,14,18,20,21,22)/p+1/t9?,10-,11+,17?/m1/s1 |
| InChIKey | BZFRLBRPFBLILL-GYVJXDFASA-O |
| XLogP | -1.08 |
| TPSA | 148.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|