About ethyl 2-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-6-oxo-5-phenyl-1H-pyridine-3-carboxylate
ethyl 2-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-6-oxo-5-phenyl-1H-pyridine-3-carboxylate (PubChem CID 90220518) has the molecular formula C23H29NO4
and a molecular weight of 383.49 g/mol. Its IUPAC name is ethyl 2-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-6-oxo-5-phenyl-1H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-6-oxo-5-phenyl-1H-pyridine-3-carboxylate |
| PubChem CID | 90220518 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | ethyl 2-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-6-oxo-5-phenyl-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(CC2CCC(C)(C)CC2)[nH]c(=O)c(-c2ccccc2)c1O |
| InChI | InChI=1S/C23H29NO4/c1-4-28-22(27)19-17(14-15-10-12-23(2,3)13-11-15)24-21(26)18(20(19)25)16-8-6-5-7-9-16/h5-9,15H,4,10-14H2,1-3H3,(H2,24,25,26) |
| InChIKey | MTAZSKHHBHAXFK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-6-oxo-5-phenyl-1H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-6-oxo-5-phenyl-1H-pyridine-3-carboxylate?
The IUPAC name of ethyl 2-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-6-oxo-5-phenyl-1H-pyridine-3-carboxylate (CID 90220518) is ethyl 2-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-6-oxo-5-phenyl-1H-pyridine-3-carboxylate.
What is the SMILES notation for ethyl 2-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-6-oxo-5-phenyl-1H-pyridine-3-carboxylate?
The canonical SMILES for ethyl 2-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-6-oxo-5-phenyl-1H-pyridine-3-carboxylate is CCOC(=O)c1c(CC2CCC(C)(C)CC2)[nH]c(=O)c(-c2ccccc2)c1O.
What is the InChIKey of ethyl 2-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-6-oxo-5-phenyl-1H-pyridine-3-carboxylate?
The InChIKey is MTAZSKHHBHAXFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29NO4/c1-4-28-22(27)19-17(14-15-10-12-23(2,3)13-11-15)24-21(26)18(20(19)25)16-8-6-5-7-9-16/h5-9,15H,4,10-14H2,1-3H3,(H2,24,25,26).
What are the key properties of ethyl 2-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-6-oxo-5-phenyl-1H-pyridine-3-carboxylate?
ethyl 2-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-6-oxo-5-phenyl-1H-pyridine-3-carboxylate has a molecular weight of 383.49 g/mol, XLogP of 4.68, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(4,4-dimethylcyclohexyl)methyl]-4-hydroxy-6-oxo-5-phenyl-1H-pyridine-3-carboxylate is sourced from PubChem (CID 90220518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).