About 5-bromo-1-fluoroindazole
5-bromo-1-fluoroindazole (PubChem CID 90220798) has the molecular formula C7H4BrFN2
and a molecular weight of 215.03 g/mol. Its IUPAC name is 5-bromo-1-fluoroindazole.
Molecular Properties
| Compound Name | 5-bromo-1-fluoroindazole |
| PubChem CID | 90220798 |
| Molecular Formula | C7H4BrFN2 |
| Molecular Weight | 215.03 g/mol |
| Exact Mass | 213.95 |
| IUPAC Name | 5-bromo-1-fluoroindazole |
| SMILES | Fn1ncc2cc(Br)ccc21 |
| InChI | InChI=1S/C7H4BrFN2/c8-6-1-2-7-5(3-6)4-10-11(7)9/h1-4H |
| InChIKey | CCIZZSCISFKVOI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.03 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-1-fluoroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-fluoroindazole?
The IUPAC name of 5-bromo-1-fluoroindazole (CID 90220798) is 5-bromo-1-fluoroindazole.
What is the SMILES notation for 5-bromo-1-fluoroindazole?
The canonical SMILES for 5-bromo-1-fluoroindazole is Fn1ncc2cc(Br)ccc21.
What is the InChIKey of 5-bromo-1-fluoroindazole?
The InChIKey is CCIZZSCISFKVOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrFN2/c8-6-1-2-7-5(3-6)4-10-11(7)9/h1-4H.
What are the key properties of 5-bromo-1-fluoroindazole?
5-bromo-1-fluoroindazole has a molecular weight of 215.03 g/mol, XLogP of 2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-fluoroindazole is sourced from PubChem (CID 90220798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).