About 5-(1-chlorocyclopropyl)pyridazine-3,4-diamine
5-(1-chlorocyclopropyl)pyridazine-3,4-diamine (PubChem CID 90220893) has the molecular formula C7H9ClN4
and a molecular weight of 184.63 g/mol. Its IUPAC name is 5-(1-chlorocyclopropyl)pyridazine-3,4-diamine.
Molecular Properties
| Compound Name | 5-(1-chlorocyclopropyl)pyridazine-3,4-diamine |
| PubChem CID | 90220893 |
| Molecular Formula | C7H9ClN4 |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 5-(1-chlorocyclopropyl)pyridazine-3,4-diamine |
| SMILES | Nc1nncc(C2(Cl)CC2)c1N |
| InChI | InChI=1S/C7H9ClN4/c8-7(1-2-7)4-3-11-12-6(10)5(4)9/h3H,1-2H2,(H2,9,11)(H2,10,12) |
| InChIKey | FRTYPLOABBDHFX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-chlorocyclopropyl)pyridazine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-chlorocyclopropyl)pyridazine-3,4-diamine?
The IUPAC name of 5-(1-chlorocyclopropyl)pyridazine-3,4-diamine (CID 90220893) is 5-(1-chlorocyclopropyl)pyridazine-3,4-diamine.
What is the SMILES notation for 5-(1-chlorocyclopropyl)pyridazine-3,4-diamine?
The canonical SMILES for 5-(1-chlorocyclopropyl)pyridazine-3,4-diamine is Nc1nncc(C2(Cl)CC2)c1N.
What is the InChIKey of 5-(1-chlorocyclopropyl)pyridazine-3,4-diamine?
The InChIKey is FRTYPLOABBDHFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN4/c8-7(1-2-7)4-3-11-12-6(10)5(4)9/h3H,1-2H2,(H2,9,11)(H2,10,12).
What are the key properties of 5-(1-chlorocyclopropyl)pyridazine-3,4-diamine?
5-(1-chlorocyclopropyl)pyridazine-3,4-diamine has a molecular weight of 184.63 g/mol, XLogP of 0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-chlorocyclopropyl)pyridazine-3,4-diamine is sourced from PubChem (CID 90220893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).