C25H29FN4O3 — CID 90221362
9-(1,3-dimethylpiperidin-4-yl)-8-(2-fluoro-3-methoxyphenyl)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one (PubChem CID 90221362) has the molecular formula C25H29FN4O3 and a molecular weight of 452.53 g/mol. Its IUPAC name is 9-(1,3-dimethylpiperidin-4-yl)-8-(2-fluoro-3-methoxyphenyl)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one.
| Compound Name | 9-(1,3-dimethylpiperidin-4-yl)-8-(2-fluoro-3-methoxyphenyl)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 90221362 |
| Molecular Formula | C25H29FN4O3 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 9-(1,3-dimethylpiperidin-4-yl)-8-(2-fluoro-3-methoxyphenyl)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
| SMILES | COc1cccc(-c2cc3c(cc2C2CCN(C)CC2C)N2C(=NNC(=O)C2C)CO3)c1F |
| InChI | InChI=1S/C25H29FN4O3/c1-14-12-29(3)9-8-16(14)18-10-20-22(33-13-23-27-28-25(31)15(2)30(20)23)11-19(18)17-6-5-7-21(32-4)24(17)26/h5-7,10-11,14-16H,8-9,12-13H2,1-4H3,(H,28,31) |
| InChIKey | IEHJOIWKZPUHQY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |