About [1-(2-tert-butyl-2,4,4-trimethylpentanoyl)-4-oxoazetidin-2-yl] propanoate
[1-(2-tert-butyl-2,4,4-trimethylpentanoyl)-4-oxoazetidin-2-yl] propanoate (PubChem CID 90221757) has the molecular formula C18H31NO4
and a molecular weight of 325.45 g/mol. Its IUPAC name is [1-(2-tert-butyl-2,4,4-trimethylpentanoyl)-4-oxoazetidin-2-yl] propanoate.
Molecular Properties
| Compound Name | [1-(2-tert-butyl-2,4,4-trimethylpentanoyl)-4-oxoazetidin-2-yl] propanoate |
| PubChem CID | 90221757 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | [1-(2-tert-butyl-2,4,4-trimethylpentanoyl)-4-oxoazetidin-2-yl] propanoate |
| SMILES | CCC(=O)OC1CC(=O)N1C(=O)C(C)(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H31NO4/c1-9-14(21)23-13-10-12(20)19(13)15(22)18(8,17(5,6)7)11-16(2,3)4/h13H,9-11H2,1-8H3 |
| InChIKey | BSOTUBRUMYYSAY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(2-tert-butyl-2,4,4-trimethylpentanoyl)-4-oxoazetidin-2-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-tert-butyl-2,4,4-trimethylpentanoyl)-4-oxoazetidin-2-yl] propanoate?
The IUPAC name of [1-(2-tert-butyl-2,4,4-trimethylpentanoyl)-4-oxoazetidin-2-yl] propanoate (CID 90221757) is [1-(2-tert-butyl-2,4,4-trimethylpentanoyl)-4-oxoazetidin-2-yl] propanoate.
What is the SMILES notation for [1-(2-tert-butyl-2,4,4-trimethylpentanoyl)-4-oxoazetidin-2-yl] propanoate?
The canonical SMILES for [1-(2-tert-butyl-2,4,4-trimethylpentanoyl)-4-oxoazetidin-2-yl] propanoate is CCC(=O)OC1CC(=O)N1C(=O)C(C)(CC(C)(C)C)C(C)(C)C.
What is the InChIKey of [1-(2-tert-butyl-2,4,4-trimethylpentanoyl)-4-oxoazetidin-2-yl] propanoate?
The InChIKey is BSOTUBRUMYYSAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO4/c1-9-14(21)23-13-10-12(20)19(13)15(22)18(8,17(5,6)7)11-16(2,3)4/h13H,9-11H2,1-8H3.
What are the key properties of [1-(2-tert-butyl-2,4,4-trimethylpentanoyl)-4-oxoazetidin-2-yl] propanoate?
[1-(2-tert-butyl-2,4,4-trimethylpentanoyl)-4-oxoazetidin-2-yl] propanoate has a molecular weight of 325.45 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-tert-butyl-2,4,4-trimethylpentanoyl)-4-oxoazetidin-2-yl] propanoate is sourced from PubChem (CID 90221757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).