C31H60N2O — CID 90222130
1-[2-methyl-3-[(13Z,16Z)-5-methyldocosa-13,16-dien-5-yl]oxypropyl]piperazine (PubChem CID 90222130) has the molecular formula C31H60N2O and a molecular weight of 476.83 g/mol. Its IUPAC name is 1-[2-methyl-3-[(13Z,16Z)-5-methyldocosa-13,16-dien-5-yl]oxypropyl]piperazine.
| Compound Name | 1-[2-methyl-3-[(13Z,16Z)-5-methyldocosa-13,16-dien-5-yl]oxypropyl]piperazine |
|---|---|
| PubChem CID | 90222130 |
| Molecular Formula | C31H60N2O |
| Molecular Weight | 476.83 g/mol |
| Exact Mass | 476.47 |
| IUPAC Name | 1-[2-methyl-3-[(13Z,16Z)-5-methyldocosa-13,16-dien-5-yl]oxypropyl]piperazine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(C)(CCCC)OCC(C)CN1CCNCC1 |
| InChI | InChI=1S/C31H60N2O/c1-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-23-31(4,22-8-6-2)34-29-30(3)28-33-26-24-32-25-27-33/h11-12,14-15,30,32H,5-10,13,16-29H2,1-4H3/b12-11-,15-14- |
| InChIKey | IAXPIPGFOITNEJ-HDXUUTQWSA-N |
| XLogP | 8.31 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.83 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|