About 4-azido-2-methylcyclohepta-1,3,5-triene
4-azido-2-methylcyclohepta-1,3,5-triene (PubChem CID 90222154) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 4-azido-2-methylcyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | 4-azido-2-methylcyclohepta-1,3,5-triene |
| PubChem CID | 90222154 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 4-azido-2-methylcyclohepta-1,3,5-triene |
| SMILES | CC1=CCC=CC(N=[N+]=[N-])=C1 |
| InChI | InChI=1S/C8H9N3/c1-7-4-2-3-5-8(6-7)10-11-9/h3-6H,2H2,1H3 |
| InChIKey | USERVMFOKPWVDV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-2-methylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-2-methylcyclohepta-1,3,5-triene?
The IUPAC name of 4-azido-2-methylcyclohepta-1,3,5-triene (CID 90222154) is 4-azido-2-methylcyclohepta-1,3,5-triene.
What is the SMILES notation for 4-azido-2-methylcyclohepta-1,3,5-triene?
The canonical SMILES for 4-azido-2-methylcyclohepta-1,3,5-triene is CC1=CCC=CC(N=[N+]=[N-])=C1.
What is the InChIKey of 4-azido-2-methylcyclohepta-1,3,5-triene?
The InChIKey is USERVMFOKPWVDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c1-7-4-2-3-5-8(6-7)10-11-9/h3-6H,2H2,1H3.
What are the key properties of 4-azido-2-methylcyclohepta-1,3,5-triene?
4-azido-2-methylcyclohepta-1,3,5-triene has a molecular weight of 147.18 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-2-methylcyclohepta-1,3,5-triene is sourced from PubChem (CID 90222154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).