About (3E,5Z)-4-azidohepta-3,5-dien-2-amine
(3E,5Z)-4-azidohepta-3,5-dien-2-amine (PubChem CID 90222170) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is (3E,5Z)-4-azidohepta-3,5-dien-2-amine.
Molecular Properties
| Compound Name | (3E,5Z)-4-azidohepta-3,5-dien-2-amine |
| PubChem CID | 90222170 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | (3E,5Z)-4-azidohepta-3,5-dien-2-amine |
| SMILES | C/C=C\C(=C/C(C)N)N=[N+]=[N-] |
| InChI | InChI=1S/C7H12N4/c1-3-4-7(10-11-9)5-6(2)8/h3-6H,8H2,1-2H3/b4-3-,7-5+ |
| InChIKey | XYULPXLPKGEUKO-QVXLNCAUSA-N |
| XLogP | 2.10 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-4-azidohepta-3,5-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-4-azidohepta-3,5-dien-2-amine?
The IUPAC name of (3E,5Z)-4-azidohepta-3,5-dien-2-amine (CID 90222170) is (3E,5Z)-4-azidohepta-3,5-dien-2-amine.
What is the SMILES notation for (3E,5Z)-4-azidohepta-3,5-dien-2-amine?
The canonical SMILES for (3E,5Z)-4-azidohepta-3,5-dien-2-amine is C/C=C\C(=C/C(C)N)N=[N+]=[N-].
What is the InChIKey of (3E,5Z)-4-azidohepta-3,5-dien-2-amine?
The InChIKey is XYULPXLPKGEUKO-QVXLNCAUSA-N. The full InChI is InChI=1S/C7H12N4/c1-3-4-7(10-11-9)5-6(2)8/h3-6H,8H2,1-2H3/b4-3-,7-5+.
What are the key properties of (3E,5Z)-4-azidohepta-3,5-dien-2-amine?
(3E,5Z)-4-azidohepta-3,5-dien-2-amine has a molecular weight of 152.20 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-4-azidohepta-3,5-dien-2-amine is sourced from PubChem (CID 90222170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).