C7H10FN — CID 90222218
(3E,5E)-6-fluorohepta-1,3,5-trien-3-amine (PubChem CID 90222218) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is (3E,5E)-6-fluorohepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-6-fluorohepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 90222218 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | (3E,5E)-6-fluorohepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C\C=C(/C)F |
| InChI | InChI=1S/C7H10FN/c1-3-7(9)5-4-6(2)8/h3-5H,1,9H2,2H3/b6-4+,7-5+ |
| InChIKey | ADFYWHQJSHBBIN-YDFGWWAZSA-N |
| XLogP | 1.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|