C24H22Cl2F3NO5 — CID 90222296
4-[3-chloro-4-[(E,4E)-6-chloro-3-hydroxy-4-(2-iminoethylidene)-3-(trifluoromethyl)hept-5-en-2-yl]phenoxy]-2-methoxybenzoic acid (PubChem CID 90222296) has the molecular formula C24H22Cl2F3NO5 and a molecular weight of 532.34 g/mol. Its IUPAC name is 4-[3-chloro-4-[(E,4E)-6-chloro-3-hydroxy-4-(2-iminoethylidene)-3-(trifluoromethyl)hept-5-en-2-yl]phenoxy]-2-methoxybenzoic acid.
| Compound Name | 4-[3-chloro-4-[(E,4E)-6-chloro-3-hydroxy-4-(2-iminoethylidene)-3-(trifluoromethyl)hept-5-en-2-yl]phenoxy]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 90222296 |
| Molecular Formula | C24H22Cl2F3NO5 |
| Molecular Weight | 532.34 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | 4-[3-chloro-4-[(E,4E)-6-chloro-3-hydroxy-4-(2-iminoethylidene)-3-(trifluoromethyl)hept-5-en-2-yl]phenoxy]-2-methoxybenzoic acid |
| SMILES | [H]/N=C/C=C(\C=C(/C)Cl)C(O)(C(C)c1ccc(Oc2ccc(C(=O)O)c(OC)c2)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C24H22Cl2F3NO5/c1-13(25)10-15(8-9-30)23(33,24(27,28)29)14(2)18-6-4-16(11-20(18)26)35-17-5-7-19(22(31)32)21(12-17)34-3/h4-12,14,30,33H,1-3H3,(H,31,32)/b13-10+,15-8+,30-9+ |
| InChIKey | BUTWNEFIDMSNBC-KYZJFTBSSA-N |
| XLogP | 6.95 |
| TPSA | 99.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.34 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|