C20H27N3O2 — CID 9022241
N-(2-ethylphenyl)-2-[4-[(2E,4E)-hexa-2,4-dienoyl]piperazin-1-yl]acetamide (PubChem CID 9022241) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[4-[(2E,4E)-hexa-2,4-dienoyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[4-[(2E,4E)-hexa-2,4-dienoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9022241 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-(2-ethylphenyl)-2-[4-[(2E,4E)-hexa-2,4-dienoyl]piperazin-1-yl]acetamide |
| SMILES | C/C=C/C=C/C(=O)N1CCN(CC(=O)Nc2ccccc2CC)CC1 |
| InChI | InChI=1S/C20H27N3O2/c1-3-5-6-11-20(25)23-14-12-22(13-15-23)16-19(24)21-18-10-8-7-9-17(18)4-2/h3,5-11H,4,12-16H2,1-2H3,(H,21,24)/b5-3+,11-6+ |
| InChIKey | LBGPOBSHEGCUIT-JFDBYLHYSA-N |
| XLogP | 2.46 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|