C37H34O2 — CID 90222419
(12R,23S)-2-phenanthren-9-ylpentacyclo[13.8.0.03,12.04,9.018,23]tricosa-5,7,9,17,19,21-hexaene-7,20-diol (PubChem CID 90222419) has the molecular formula C37H34O2 and a molecular weight of 510.68 g/mol. Its IUPAC name is (12R,23S)-2-phenanthren-9-ylpentacyclo[13.8.0.03,12.04,9.018,23]tricosa-5,7,9,17,19,21-hexaene-7,20-diol.
| Compound Name | (12R,23S)-2-phenanthren-9-ylpentacyclo[13.8.0.03,12.04,9.018,23]tricosa-5,7,9,17,19,21-hexaene-7,20-diol |
|---|---|
| PubChem CID | 90222419 |
| Molecular Formula | C37H34O2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | (12R,23S)-2-phenanthren-9-ylpentacyclo[13.8.0.03,12.04,9.018,23]tricosa-5,7,9,17,19,21-hexaene-7,20-diol |
| SMILES | OC1=CC2=CC[C@H]3CCC4CC=C5C=C(O)C=C[C@H]5C4C(c4cc5ccccc5c5ccccc45)C3C2C=C1 |
| InChI | InChI=1S/C37H34O2/c38-27-15-17-30-25(19-27)13-11-22-9-10-23-12-14-26-20-28(39)16-18-31(26)36(23)37(35(22)30)34-21-24-5-1-2-6-29(24)32-7-3-4-8-33(32)34/h1-8,13-23,30-31,35-39H,9-12H2/t22-,23?,30?,31-,35?,36?,37?/m1/s1 |
| InChIKey | AGAPRSUWWOSDJK-MCGPINRSSA-N |
| XLogP | 9.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|