C39H18F6O7 — CID 90222632
14,18-diphenyl-14,18-bis(trifluoromethyl)-4,9,28-trioxaheptacyclo[15.11.0.03,15.05,13.07,11.019,27.021,25]octacosa-1,3(15),5(13),6,11,16,19(27),20,25-nonaene-8,10,22,24-tetrone (PubChem CID 90222632) has the molecular formula C39H18F6O7 and a molecular weight of 712.55 g/mol. Its IUPAC name is 14,18-diphenyl-14,18-bis(trifluoromethyl)-4,9,28-trioxaheptacyclo[15.11.0.03,15.05,13.07,11.019,27.021,25]octacosa-1,3(15),5(13),6,11,16,19(27),20,25-nonaene-8,10,22,24-tetrone.
| Compound Name | 14,18-diphenyl-14,18-bis(trifluoromethyl)-4,9,28-trioxaheptacyclo[15.11.0.03,15.05,13.07,11.019,27.021,25]octacosa-1,3(15),5(13),6,11,16,19(27),20,25-nonaene-8,10,22,24-tetrone |
|---|---|
| PubChem CID | 90222632 |
| Molecular Formula | C39H18F6O7 |
| Molecular Weight | 712.55 g/mol |
| Exact Mass | 712.10 |
| IUPAC Name | 14,18-diphenyl-14,18-bis(trifluoromethyl)-4,9,28-trioxaheptacyclo[15.11.0.03,15.05,13.07,11.019,27.021,25]octacosa-1,3(15),5(13),6,11,16,19(27),20,25-nonaene-8,10,22,24-tetrone |
| SMILES | O=C1CC(=O)c2cc3c(cc21)Oc1cc2c(cc1C3(c1ccccc1)C(F)(F)F)C(c1ccccc1)(C(F)(F)F)c1cc3c(cc1O2)C(=O)OC3=O |
| InChI | InChI=1S/C39H18F6O7/c40-38(41,42)36(18-7-3-1-4-8-18)24-11-20-21(29(47)16-28(20)46)13-30(24)50-32-17-33-27(15-26(32)36)37(39(43,44)45,19-9-5-2-6-10-19)25-12-22-23(14-31(25)51-33)35(49)52-34(22)48/h1-15,17H,16H2 |
| InChIKey | IFCUHGBJGOKNLL-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.55 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|