C26H13F3O5 — CID 90222633
2-phenyl-2-(trifluoromethyl)-7-oxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-6,8,16,18-tetrone (PubChem CID 90222633) has the molecular formula C26H13F3O5 and a molecular weight of 462.38 g/mol. Its IUPAC name is 2-phenyl-2-(trifluoromethyl)-7-oxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-6,8,16,18-tetrone.
| Compound Name | 2-phenyl-2-(trifluoromethyl)-7-oxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-6,8,16,18-tetrone |
|---|---|
| PubChem CID | 90222633 |
| Molecular Formula | C26H13F3O5 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 2-phenyl-2-(trifluoromethyl)-7-oxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-6,8,16,18-tetrone |
| SMILES | O=C1CC(=O)c2cc3c(cc21)Cc1cc2c(cc1C3(c1ccccc1)C(F)(F)F)C(=O)OC2=O |
| InChI | InChI=1S/C26H13F3O5/c27-26(28,29)25(14-4-2-1-3-5-14)19-9-16-15(21(30)11-22(16)31)7-12(19)6-13-8-17-18(10-20(13)25)24(33)34-23(17)32/h1-5,7-10H,6,11H2 |
| InChIKey | DOQYVTDIDCITKI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|