About 3-phenacylsulfanylpropyl methanesulfonate
3-phenacylsulfanylpropyl methanesulfonate (PubChem CID 90222659) has the molecular formula C12H16O4S2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-phenacylsulfanylpropyl methanesulfonate.
Molecular Properties
| Compound Name | 3-phenacylsulfanylpropyl methanesulfonate |
| PubChem CID | 90222659 |
| Molecular Formula | C12H16O4S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 3-phenacylsulfanylpropyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCSCC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16O4S2/c1-18(14,15)16-8-5-9-17-10-12(13)11-6-3-2-4-7-11/h2-4,6-7H,5,8-10H2,1H3 |
| InChIKey | DQFDRICVNPVJDM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-phenacylsulfanylpropyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenacylsulfanylpropyl methanesulfonate?
The IUPAC name of 3-phenacylsulfanylpropyl methanesulfonate (CID 90222659) is 3-phenacylsulfanylpropyl methanesulfonate.
What is the SMILES notation for 3-phenacylsulfanylpropyl methanesulfonate?
The canonical SMILES for 3-phenacylsulfanylpropyl methanesulfonate is CS(=O)(=O)OCCCSCC(=O)c1ccccc1.
What is the InChIKey of 3-phenacylsulfanylpropyl methanesulfonate?
The InChIKey is DQFDRICVNPVJDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4S2/c1-18(14,15)16-8-5-9-17-10-12(13)11-6-3-2-4-7-11/h2-4,6-7H,5,8-10H2,1H3.
What are the key properties of 3-phenacylsulfanylpropyl methanesulfonate?
3-phenacylsulfanylpropyl methanesulfonate has a molecular weight of 288.39 g/mol, XLogP of 1.97, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenacylsulfanylpropyl methanesulfonate is sourced from PubChem (CID 90222659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).