About [(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-enyl] ethyl carbonate
[(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-enyl] ethyl carbonate (PubChem CID 90223917) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is [(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-enyl] ethyl carbonate.
Molecular Properties
| Compound Name | [(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-enyl] ethyl carbonate |
| PubChem CID | 90223917 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | [(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-enyl] ethyl carbonate |
| SMILES | C=C[C@@H](OC(=O)OCC)[C@H]1C=CCO1 |
| InChI | InChI=1S/C10H14O4/c1-3-8(9-6-5-7-13-9)14-10(11)12-4-2/h3,5-6,8-9H,1,4,7H2,2H3/t8-,9-/m1/s1 |
| InChIKey | KLRDHSOTCSVSNO-RKDXNWHRSA-N |
| XLogP | 1.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-enyl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-enyl] ethyl carbonate?
The IUPAC name of [(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-enyl] ethyl carbonate (CID 90223917) is [(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-enyl] ethyl carbonate.
What is the SMILES notation for [(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-enyl] ethyl carbonate?
The canonical SMILES for [(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-enyl] ethyl carbonate is C=C[C@@H](OC(=O)OCC)[C@H]1C=CCO1.
What is the InChIKey of [(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-enyl] ethyl carbonate?
The InChIKey is KLRDHSOTCSVSNO-RKDXNWHRSA-N. The full InChI is InChI=1S/C10H14O4/c1-3-8(9-6-5-7-13-9)14-10(11)12-4-2/h3,5-6,8-9H,1,4,7H2,2H3/t8-,9-/m1/s1.
What are the key properties of [(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-enyl] ethyl carbonate?
[(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-enyl] ethyl carbonate has a molecular weight of 198.22 g/mol, XLogP of 1.67, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-[(2R)-2,5-dihydrofuran-2-yl]prop-2-enyl] ethyl carbonate is sourced from PubChem (CID 90223917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).